About 1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene
1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene (PubChem CID 15855234) has the molecular formula C16H16Br2
and a molecular weight of 368.11 g/mol. Its IUPAC name is 1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene |
| PubChem CID | 15855234 |
| Molecular Formula | C16H16Br2 |
| Molecular Weight | 368.11 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene |
| SMILES | Cc1cc(Br)c(-c2cc(C)c(C)cc2Br)cc1C |
| InChI | InChI=1S/C16H16Br2/c1-9-5-13(15(17)7-11(9)3)14-6-10(2)12(4)8-16(14)18/h5-8H,1-4H3 |
| InChIKey | PIPDXSMIRHGCHX-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.11 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene?
The IUPAC name of 1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene (CID 15855234) is 1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene.
What is the SMILES notation for 1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene?
The canonical SMILES for 1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene is Cc1cc(Br)c(-c2cc(C)c(C)cc2Br)cc1C.
What is the InChIKey of 1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene?
The InChIKey is PIPDXSMIRHGCHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Br2/c1-9-5-13(15(17)7-11(9)3)14-6-10(2)12(4)8-16(14)18/h5-8H,1-4H3.
What are the key properties of 1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene?
1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene has a molecular weight of 368.11 g/mol, XLogP of 6.11, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-(2-bromo-4,5-dimethylphenyl)-4,5-dimethylbenzene is sourced from PubChem (CID 15855234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).