C29H24F3N5O2 — CID 158552362
6-(5,7-difluoro-1H-indol-3-yl)-3-fluoro-5-isocyano-N-[(2S,3S)-3-methyl-2-bicyclo[2.2.2]octanyl]-4-(4-nitrophenyl)pyridin-2-amine (PubChem CID 158552362) has the molecular formula C29H24F3N5O2 and a molecular weight of 531.54 g/mol. Its IUPAC name is 6-(5,7-difluoro-1H-indol-3-yl)-3-fluoro-5-isocyano-N-[(2S,3S)-3-methyl-2-bicyclo[2.2.2]octanyl]-4-(4-nitrophenyl)pyridin-2-amine.
| Compound Name | 6-(5,7-difluoro-1H-indol-3-yl)-3-fluoro-5-isocyano-N-[(2S,3S)-3-methyl-2-bicyclo[2.2.2]octanyl]-4-(4-nitrophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 158552362 |
| Molecular Formula | C29H24F3N5O2 |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 6-(5,7-difluoro-1H-indol-3-yl)-3-fluoro-5-isocyano-N-[(2S,3S)-3-methyl-2-bicyclo[2.2.2]octanyl]-4-(4-nitrophenyl)pyridin-2-amine |
| SMILES | [C-]#[N+]c1c(-c2c[nH]c3c(F)cc(F)cc23)nc(N[C@H]2C3CCC(CC3)[C@@H]2C)c(F)c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H24F3N5O2/c1-14-15-3-5-17(6-4-15)25(14)35-29-24(32)23(16-7-9-19(10-8-16)37(38)39)28(33-2)27(36-29)21-13-34-26-20(21)11-18(30)12-22(26)31/h7-15,17,25,34H,3-6H2,1H3,(H,35,36)/t14-,15?,17?,25+/m0/s1 |
| InChIKey | QLTQQDXMDPRLMK-AALSTGTISA-N |
| XLogP | 8.01 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|