C14H28O2S — CID 158552545
5,5-dimethylhexan-2-ylsulfonylcyclohexane (PubChem CID 158552545) has the molecular formula C14H28O2S and a molecular weight of 260.44 g/mol. Its IUPAC name is 5,5-dimethylhexan-2-ylsulfonylcyclohexane.
| Compound Name | 5,5-dimethylhexan-2-ylsulfonylcyclohexane |
|---|---|
| PubChem CID | 158552545 |
| Molecular Formula | C14H28O2S |
| Molecular Weight | 260.44 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 5,5-dimethylhexan-2-ylsulfonylcyclohexane |
| SMILES | CC(CCC(C)(C)C)S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C14H28O2S/c1-12(10-11-14(2,3)4)17(15,16)13-8-6-5-7-9-13/h12-13H,5-11H2,1-4H3 |
| InChIKey | CSTPTSNHENKUPW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |