About CID 158554461
CID 158554461 (PubChem CID 158554461) has the molecular formula C4H14BOSi
and a molecular weight of 117.05 g/mol.
Molecular Properties
| Compound Name | CID 158554461 |
| PubChem CID | 158554461 |
| Molecular Formula | C4H14BOSi |
| Molecular Weight | 117.05 g/mol |
| Exact Mass | 117.09 |
| IUPAC Name | — |
| SMILES | C.C[B][SiH](C)OC |
| InChI | InChI=1S/C3H10BOSi.CH4/c1-4-6(3)5-2;/h6H,1-3H3;1H4 |
| InChIKey | WSGWJVFTFUNUTC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.05 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158554461 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158554461?
The IUPAC name of CID 158554461 (CID 158554461) is not available.
What is the SMILES notation for CID 158554461?
The canonical SMILES for CID 158554461 is C.C[B][SiH](C)OC.
What is the InChIKey of CID 158554461?
The InChIKey is WSGWJVFTFUNUTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10BOSi.CH4/c1-4-6(3)5-2;/h6H,1-3H3;1H4.
What are the key properties of CID 158554461?
CID 158554461 has a molecular weight of 117.05 g/mol, XLogP of 0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158554461 is sourced from PubChem (CID 158554461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).