About 6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine
6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine (PubChem CID 158554533) has the molecular formula C12H17N5
and a molecular weight of 231.30 g/mol. Its IUPAC name is 6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine |
| PubChem CID | 158554533 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N)c2nc(C(C)(C)C)nc(C)c2n1 |
| InChI | InChI=1S/C12H17N5/c1-6-8-9(10(13)16-7(2)15-8)17-11(14-6)12(3,4)5/h1-5H3,(H2,13,15,16) |
| InChIKey | FAUHOUCHYYARQY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine?
The IUPAC name of 6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine (CID 158554533) is 6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine.
What is the SMILES notation for 6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine?
The canonical SMILES for 6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine is Cc1nc(N)c2nc(C(C)(C)C)nc(C)c2n1.
What is the InChIKey of 6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine?
The InChIKey is FAUHOUCHYYARQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5/c1-6-8-9(10(13)16-7(2)15-8)17-11(14-6)12(3,4)5/h1-5H3,(H2,13,15,16).
What are the key properties of 6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine?
6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine has a molecular weight of 231.30 g/mol, XLogP of 1.92, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2,8-dimethylpyrimido[5,4-d]pyrimidin-4-amine is sourced from PubChem (CID 158554533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).