C40H34BIN4O12S2 — CID 158555346
ethyl 3-(furan-3-yl)-1-phenylsulfanylperoxypyrrolo[2,3-b]pyridine-5-carboxylate;ethyl 3-iodo-1-phenylsulfanylperoxypyrrolo[2,3-b]pyridine-5-carboxylate;furan-3-ylboronic acid (PubChem CID 158555346) has the molecular formula C40H34BIN4O12S2 and a molecular weight of 964.58 g/mol. Its IUPAC name is ethyl 3-(furan-3-yl)-1-phenylsulfanylperoxypyrrolo[2,3-b]pyridine-5-carboxylate;ethyl 3-iodo-1-phenylsulfanylperoxypyrrolo[2,3-b]pyridine-5-carboxylate;furan-3-ylboronic acid.
| Compound Name | ethyl 3-(furan-3-yl)-1-phenylsulfanylperoxypyrrolo[2,3-b]pyridine-5-carboxylate;ethyl 3-iodo-1-phenylsulfanylperoxypyrrolo[2,3-b]pyridine-5-carboxylate;furan-3-ylboronic acid |
|---|---|
| PubChem CID | 158555346 |
| Molecular Formula | C40H34BIN4O12S2 |
| Molecular Weight | 964.58 g/mol |
| Exact Mass | 964.08 |
| IUPAC Name | ethyl 3-(furan-3-yl)-1-phenylsulfanylperoxypyrrolo[2,3-b]pyridine-5-carboxylate;ethyl 3-iodo-1-phenylsulfanylperoxypyrrolo[2,3-b]pyridine-5-carboxylate;furan-3-ylboronic acid |
| SMILES | CCOC(=O)c1cnc2c(c1)c(-c1ccoc1)cn2OOSc1ccccc1.CCOC(=O)c1cnc2c(c1)c(I)cn2OOSc1ccccc1.OB(O)c1ccoc1 |
| InChI | InChI=1S/C20H16N2O5S.C16H13IN2O4S.C4H5BO3/c1-2-25-20(23)15-10-17-18(14-8-9-24-13-14)12-22(19(17)21-11-15)26-27-28-16-6-4-3-5-7-16;1-2-21-16(20)11-8-13-14(17)10-19(15(13)18-9-11)22-23-24-12-6-4-3-5-7-12;6-5(7)4-1-2-8-3-4/h3-13H,2H2,1H3;3-10H,2H2,1H3;1-3,6-7H |
| InChIKey | HQFKBHJVLJHLAQ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 191.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.58 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|