C21H30NO3PS — CID 158556925
N,N-diethylethanamine;(4S,6R)-2-hydroxy-4,6-diphenyl-1,3,2λ5-oxathiaphosphinane 2-oxide (PubChem CID 158556925) has the molecular formula C21H30NO3PS and a molecular weight of 407.52 g/mol. Its IUPAC name is N,N-diethylethanamine;(4S,6R)-2-hydroxy-4,6-diphenyl-1,3,2λ5-oxathiaphosphinane 2-oxide.
| Compound Name | N,N-diethylethanamine;(4S,6R)-2-hydroxy-4,6-diphenyl-1,3,2λ5-oxathiaphosphinane 2-oxide |
|---|---|
| PubChem CID | 158556925 |
| Molecular Formula | C21H30NO3PS |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N,N-diethylethanamine;(4S,6R)-2-hydroxy-4,6-diphenyl-1,3,2λ5-oxathiaphosphinane 2-oxide |
| SMILES | CCN(CC)CC.O=P1(O)O[C@@H](c2ccccc2)C[C@@H](c2ccccc2)S1 |
| InChI | InChI=1S/C15H15O3PS.C6H15N/c16-19(17)18-14(12-7-3-1-4-8-12)11-15(20-19)13-9-5-2-6-10-13;1-4-7(5-2)6-3/h1-10,14-15H,11H2,(H,16,17);4-6H2,1-3H3/t14-,15+;/m1./s1 |
| InChIKey | HQKHTMIIRHUOIT-LIOBNPLQSA-N |
| XLogP | 6.07 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|