C27H36N2O5 — CID 158557540
6-[2,6-dimethyl-4-[3-oxo-3-(3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl)propyl]phenoxy]-1,5-dihydroxyhexan-2-one (PubChem CID 158557540) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is 6-[2,6-dimethyl-4-[3-oxo-3-(3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl)propyl]phenoxy]-1,5-dihydroxyhexan-2-one.
| Compound Name | 6-[2,6-dimethyl-4-[3-oxo-3-(3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl)propyl]phenoxy]-1,5-dihydroxyhexan-2-one |
|---|---|
| PubChem CID | 158557540 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 6-[2,6-dimethyl-4-[3-oxo-3-(3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl)propyl]phenoxy]-1,5-dihydroxyhexan-2-one |
| SMILES | Cc1cc(CCC(=O)n2nc(C)c3c2CC2C3C2(C)C)cc(C)c1OCC(O)CCC(=O)CO |
| InChI | InChI=1S/C27H36N2O5/c1-15-10-18(11-16(2)26(15)34-14-20(32)8-7-19(31)13-30)6-9-23(33)29-22-12-21-25(27(21,4)5)24(22)17(3)28-29/h10-11,20-21,25,30,32H,6-9,12-14H2,1-5H3 |
| InChIKey | OQEGCUYZHXBNLZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |