About 3,5-bis(prop-1-enyl)pyrylium-2,6-diide
3,5-bis(prop-1-enyl)pyrylium-2,6-diide (PubChem CID 158559278) has the molecular formula C11H11O-
and a molecular weight of 159.21 g/mol. Its IUPAC name is 3,5-bis(prop-1-enyl)pyrylium-2,6-diide.
Molecular Properties
| Compound Name | 3,5-bis(prop-1-enyl)pyrylium-2,6-diide |
| PubChem CID | 158559278 |
| Molecular Formula | C11H11O- |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 3,5-bis(prop-1-enyl)pyrylium-2,6-diide |
| SMILES | CC=Cc1[c-][o+][c-]c(C=CC)c1 |
| InChI | InChI=1S/C11H11O/c1-3-5-10-7-11(6-4-2)9-12-8-10/h3-7H,1-2H3/q-1 |
| InChIKey | QHMDBFRUWBIKOP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(prop-1-enyl)pyrylium-2,6-diide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(prop-1-enyl)pyrylium-2,6-diide?
The IUPAC name of 3,5-bis(prop-1-enyl)pyrylium-2,6-diide (CID 158559278) is 3,5-bis(prop-1-enyl)pyrylium-2,6-diide.
What is the SMILES notation for 3,5-bis(prop-1-enyl)pyrylium-2,6-diide?
The canonical SMILES for 3,5-bis(prop-1-enyl)pyrylium-2,6-diide is CC=Cc1[c-][o+][c-]c(C=CC)c1.
What is the InChIKey of 3,5-bis(prop-1-enyl)pyrylium-2,6-diide?
The InChIKey is QHMDBFRUWBIKOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11O/c1-3-5-10-7-11(6-4-2)9-12-8-10/h3-7H,1-2H3/q-1.
What are the key properties of 3,5-bis(prop-1-enyl)pyrylium-2,6-diide?
3,5-bis(prop-1-enyl)pyrylium-2,6-diide has a molecular weight of 159.21 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(prop-1-enyl)pyrylium-2,6-diide is sourced from PubChem (CID 158559278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).