chloric acid;chlorous acid;perchloric acid

H3Cl3O9 — CID 158559419

IUPACchloric acid;chlorous acid;perchloric acid
SMILES[O-][Cl+2]([O-])O.[O-][Cl+3]([O-])([O-])O.[O-][Cl+]O
InChIInChI=1S/ClHO4.ClHO3.ClHO2/c2-1(3,4)5;2-1(3)4;2-1-3/h(H,2,3,4,5);2H;2H
InChIKeyFZQVXGUHUKKJSD-UHFFFAOYSA-N
MW253.37 g/mol
LogP-8.81
Rot. Bonds

About chloric acid;chlorous acid;perchloric acid

chloric acid;chlorous acid;perchloric acid (PubChem CID 158559419) has the molecular formula H3Cl3O9 and a molecular weight of 253.37 g/mol. Its IUPAC name is chloric acid;chlorous acid;perchloric acid.

Molecular Properties

Compound Namechloric acid;chlorous acid;perchloric acid
PubChem CID158559419
Molecular FormulaH3Cl3O9
Molecular Weight253.37 g/mol
Exact Mass251.88
IUPAC Namechloric acid;chlorous acid;perchloric acid
SMILES[O-][Cl+2]([O-])O.[O-][Cl+3]([O-])([O-])O.[O-][Cl+]O
InChIInChI=1S/ClHO4.ClHO3.ClHO2/c2-1(3,4)5;2-1(3)4;2-1-3/h(H,2,3,4,5);2H;2H
InChIKeyFZQVXGUHUKKJSD-UHFFFAOYSA-N
XLogP-8.81
TPSA199.05 Ų
H-Bond Donors3
H-Bond Acceptors9
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.37
LogP ≤ 5-8.81
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 109

Analyze chloric acid;chlorous acid;perchloric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of chloric acid;chlorous acid;perchloric acid?
The IUPAC name of chloric acid;chlorous acid;perchloric acid (CID 158559419) is chloric acid;chlorous acid;perchloric acid.
What is the SMILES notation for chloric acid;chlorous acid;perchloric acid?
The canonical SMILES for chloric acid;chlorous acid;perchloric acid is [O-][Cl+2]([O-])O.[O-][Cl+3]([O-])([O-])O.[O-][Cl+]O.
What is the InChIKey of chloric acid;chlorous acid;perchloric acid?
The InChIKey is FZQVXGUHUKKJSD-UHFFFAOYSA-N. The full InChI is InChI=1S/ClHO4.ClHO3.ClHO2/c2-1(3,4)5;2-1(3)4;2-1-3/h(H,2,3,4,5);2H;2H.
What are the key properties of chloric acid;chlorous acid;perchloric acid?
chloric acid;chlorous acid;perchloric acid has a molecular weight of 253.37 g/mol, XLogP of -8.81, 0 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for chloric acid;chlorous acid;perchloric acid is sourced from PubChem (CID 158559419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).