C37H26Br2FN — CID 158559593
1-bromo-3-fluorobenzene;9-(3-bromophenyl)carbazole;9H-fluorene (PubChem CID 158559593) has the molecular formula C37H26Br2FN and a molecular weight of 663.43 g/mol. Its IUPAC name is 1-bromo-3-fluorobenzene;9-(3-bromophenyl)carbazole;9H-fluorene.
| Compound Name | 1-bromo-3-fluorobenzene;9-(3-bromophenyl)carbazole;9H-fluorene |
|---|---|
| PubChem CID | 158559593 |
| Molecular Formula | C37H26Br2FN |
| Molecular Weight | 663.43 g/mol |
| Exact Mass | 661.04 |
| IUPAC Name | 1-bromo-3-fluorobenzene;9-(3-bromophenyl)carbazole;9H-fluorene |
| SMILES | Brc1cccc(-n2c3ccccc3c3ccccc32)c1.Fc1cccc(Br)c1.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C18H12BrN.C13H10.C6H4BrF/c19-13-6-5-7-14(12-13)20-17-10-3-1-8-15(17)16-9-2-4-11-18(16)20;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;7-5-2-1-3-6(8)4-5/h1-12H;1-8H,9H2;1-4H |
| InChIKey | HQSGTYWYCQCPFM-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.43 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |