C25H18ClN3O5 — CID 15856015
(3S,3aS,6aR)-2-(4-chlorophenyl)-3-[(E)-2-(2-nitrophenyl)ethenyl]-5-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 15856015) has the molecular formula C25H18ClN3O5 and a molecular weight of 475.89 g/mol. Its IUPAC name is (3S,3aS,6aR)-2-(4-chlorophenyl)-3-[(E)-2-(2-nitrophenyl)ethenyl]-5-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aS,6aR)-2-(4-chlorophenyl)-3-[(E)-2-(2-nitrophenyl)ethenyl]-5-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 15856015 |
| Molecular Formula | C25H18ClN3O5 |
| Molecular Weight | 475.89 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | (3S,3aS,6aR)-2-(4-chlorophenyl)-3-[(E)-2-(2-nitrophenyl)ethenyl]-5-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1[C@@H]2[C@@H](ON(c3ccc(Cl)cc3)[C@H]2/C=C/c2ccccc2[N+](=O)[O-])C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C25H18ClN3O5/c26-17-11-13-19(14-12-17)28-21(15-10-16-6-4-5-9-20(16)29(32)33)22-23(34-28)25(31)27(24(22)30)18-7-2-1-3-8-18/h1-15,21-23H/b15-10+/t21-,22-,23+/m0/s1 |
| InChIKey | MGLKARFNFZOMID-OBSHBMASSA-N |
| XLogP | 4.64 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.89 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|