About 5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene
5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene (PubChem CID 15856028) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene.
Molecular Properties
| Compound Name | 5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene |
| PubChem CID | 15856028 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene |
| SMILES | COCC12C=CC3C(C=C1)C32 |
| InChI | InChI=1S/C10H12O/c1-11-6-10-4-2-7-8(3-5-10)9(7)10/h2-5,7-9H,6H2,1H3 |
| InChIKey | BKROTEQRBSTMEA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene?
The IUPAC name of 5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene (CID 15856028) is 5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene.
What is the SMILES notation for 5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene?
The canonical SMILES for 5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene is COCC12C=CC3C(C=C1)C32.
What is the InChIKey of 5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene?
The InChIKey is BKROTEQRBSTMEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c1-11-6-10-4-2-7-8(3-5-10)9(7)10/h2-5,7-9H,6H2,1H3.
What are the key properties of 5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene?
5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene has a molecular weight of 148.20 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)tricyclo[3.3.0.02,8]octa-3,6-diene is sourced from PubChem (CID 15856028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).