About bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol
bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol (PubChem CID 158560706) has the molecular formula C25H16Cl4O7S
and a molecular weight of 602.28 g/mol. Its IUPAC name is bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol.
Molecular Properties
| Compound Name | bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol |
| PubChem CID | 158560706 |
| Molecular Formula | C25H16Cl4O7S |
| Molecular Weight | 602.28 g/mol |
| Exact Mass | 599.94 |
| IUPAC Name | bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol |
| SMILES | O=C(c1cc(Cl)c(O)c(Cl)c1)c1cc(Cl)c(O)c(Cl)c1.O=S(=O)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H6Cl4O3.C12H10O4S/c14-7-1-5(2-8(15)12(7)19)11(18)6-3-9(16)13(20)10(17)4-6;13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-4,19-20H;1-8,13-14H |
| InChIKey | HQVSTFHRLKKNDN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 602.28 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol?
The IUPAC name of bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol (CID 158560706) is bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol.
What is the SMILES notation for bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol?
The canonical SMILES for bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol is O=C(c1cc(Cl)c(O)c(Cl)c1)c1cc(Cl)c(O)c(Cl)c1.O=S(=O)(c1ccc(O)cc1)c1ccc(O)cc1.
What is the InChIKey of bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol?
The InChIKey is HQVSTFHRLKKNDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6Cl4O3.C12H10O4S/c14-7-1-5(2-8(15)12(7)19)11(18)6-3-9(16)13(20)10(17)4-6;13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-4,19-20H;1-8,13-14H.
What are the key properties of bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol?
bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol has a molecular weight of 602.28 g/mol, XLogP of 6.87, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,5-dichloro-4-hydroxyphenyl)methanone;4-(4-hydroxyphenyl)sulfonylphenol is sourced from PubChem (CID 158560706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).