C57H68F5N3O6 — CID 158560946
ethyl 1-decylindole-2-carboxylate;ethyl 1H-indole-2-carboxylate;(2,3,4,5,6-pentafluorophenyl) 1-decylindole-2-carboxylate (PubChem CID 158560946) has the molecular formula C57H68F5N3O6 and a molecular weight of 986.18 g/mol. Its IUPAC name is ethyl 1-decylindole-2-carboxylate;ethyl 1H-indole-2-carboxylate;(2,3,4,5,6-pentafluorophenyl) 1-decylindole-2-carboxylate.
| Compound Name | ethyl 1-decylindole-2-carboxylate;ethyl 1H-indole-2-carboxylate;(2,3,4,5,6-pentafluorophenyl) 1-decylindole-2-carboxylate |
|---|---|
| PubChem CID | 158560946 |
| Molecular Formula | C57H68F5N3O6 |
| Molecular Weight | 986.18 g/mol |
| Exact Mass | 985.50 |
| IUPAC Name | ethyl 1-decylindole-2-carboxylate;ethyl 1H-indole-2-carboxylate;(2,3,4,5,6-pentafluorophenyl) 1-decylindole-2-carboxylate |
| SMILES | CCCCCCCCCCn1c(C(=O)OCC)cc2ccccc21.CCCCCCCCCCn1c(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc2ccccc21.CCOC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H26F5NO2.C21H31NO2.C11H11NO2/c1-2-3-4-5-6-7-8-11-14-31-17-13-10-9-12-16(17)15-18(31)25(32)33-24-22(29)20(27)19(26)21(28)23(24)30;1-3-5-6-7-8-9-10-13-16-22-19-15-12-11-14-18(19)17-20(22)21(23)24-4-2;1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10/h9-10,12-13,15H,2-8,11,14H2,1H3;11-12,14-15,17H,3-10,13,16H2,1-2H3;3-7,12H,2H2,1H3 |
| InChIKey | HQWMQVKRHGGCGZ-UHFFFAOYSA-N |
| XLogP | 16.00 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.18 |
| LogP ≤ 5 | 16.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|