C60H54N6O6 — CID 158561252
2,2-bis(1-methylindol-3-yl)acetic acid;methyl 2,2-bis(1H-indol-3-yl)acetate;methyl 2,2-bis(1-methylindol-3-yl)acetate (PubChem CID 158561252) has the molecular formula C60H54N6O6 and a molecular weight of 955.13 g/mol. Its IUPAC name is 2,2-bis(1-methylindol-3-yl)acetic acid;methyl 2,2-bis(1H-indol-3-yl)acetate;methyl 2,2-bis(1-methylindol-3-yl)acetate.
| Compound Name | 2,2-bis(1-methylindol-3-yl)acetic acid;methyl 2,2-bis(1H-indol-3-yl)acetate;methyl 2,2-bis(1-methylindol-3-yl)acetate |
|---|---|
| PubChem CID | 158561252 |
| Molecular Formula | C60H54N6O6 |
| Molecular Weight | 955.13 g/mol |
| Exact Mass | 954.41 |
| IUPAC Name | 2,2-bis(1-methylindol-3-yl)acetic acid;methyl 2,2-bis(1H-indol-3-yl)acetate;methyl 2,2-bis(1-methylindol-3-yl)acetate |
| SMILES | COC(=O)C(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12.COC(=O)C(c1cn(C)c2ccccc12)c1cn(C)c2ccccc12.Cn1cc(C(C(=O)O)c2cn(C)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C21H20N2O2.C20H18N2O2.C19H16N2O2/c1-22-12-16(14-8-4-6-10-18(14)22)20(21(24)25-3)17-13-23(2)19-11-7-5-9-15(17)19;1-21-11-15(13-7-3-5-9-17(13)21)19(20(23)24)16-12-22(2)18-10-6-4-8-14(16)18;1-23-19(22)18(14-10-20-16-8-4-2-6-12(14)16)15-11-21-17-9-5-3-7-13(15)17/h4-13,20H,1-3H3;3-12,19H,1-2H3,(H,23,24);2-11,18,20-21H,1H3 |
| InChIKey | HQXJLUBYYXJWGZ-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 141.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.13 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |