C22H26BBrN4O2 — CID 158565348
6-bromo-2-methylindazole;2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 158565348) has the molecular formula C22H26BBrN4O2 and a molecular weight of 469.19 g/mol. Its IUPAC name is 6-bromo-2-methylindazole;2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 6-bromo-2-methylindazole;2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 158565348 |
| Molecular Formula | C22H26BBrN4O2 |
| Molecular Weight | 469.19 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 6-bromo-2-methylindazole;2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Cn1cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2n1.Cn1cc2ccc(Br)cc2n1 |
| InChI | InChI=1S/C14H19BN2O2.C8H7BrN2/c1-13(2)14(3,4)19-15(18-13)11-7-6-10-9-17(5)16-12(10)8-11;1-11-5-6-2-3-7(9)4-8(6)10-11/h6-9H,1-5H3;2-5H,1H3 |
| InChIKey | HRKDZWVQYFQONG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.19 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|