C38H46Si3 — CID 158565683
ethyl-[3-[1-(3-ethylsilylpropyl)-2,3,4,5-tetraphenylsilol-1-yl]propyl]silane (PubChem CID 158565683) has the molecular formula C38H46Si3 and a molecular weight of 587.04 g/mol. Its IUPAC name is ethyl-[3-[1-(3-ethylsilylpropyl)-2,3,4,5-tetraphenylsilol-1-yl]propyl]silane.
| Compound Name | ethyl-[3-[1-(3-ethylsilylpropyl)-2,3,4,5-tetraphenylsilol-1-yl]propyl]silane |
|---|---|
| PubChem CID | 158565683 |
| Molecular Formula | C38H46Si3 |
| Molecular Weight | 587.04 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | ethyl-[3-[1-(3-ethylsilylpropyl)-2,3,4,5-tetraphenylsilol-1-yl]propyl]silane |
| SMILES | CC[SiH2]CCC[Si]1(CCC[SiH2]CC)C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C38H46Si3/c1-3-39-27-17-29-41(30-18-28-40-4-2)37(33-23-13-7-14-24-33)35(31-19-9-5-10-20-31)36(32-21-11-6-12-22-32)38(41)34-25-15-8-16-26-34/h5-16,19-26H,3-4,17-18,27-30,39-40H2,1-2H3 |
| InChIKey | DMBVLZLWVSIASX-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.04 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|