C12H7Cl2NO4S2 — CID 158566439
carbon dioxide;(5Z)-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 158566439) has the molecular formula C12H7Cl2NO4S2 and a molecular weight of 364.23 g/mol. Its IUPAC name is carbon dioxide;(5Z)-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | carbon dioxide;(5Z)-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 158566439 |
| Molecular Formula | C12H7Cl2NO4S2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 362.92 |
| IUPAC Name | carbon dioxide;(5Z)-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C/c2cc(Cl)c(O)c(Cl)c2)SC1=S.O=C=O |
| InChI | InChI=1S/C11H7Cl2NO2S2.CO2/c1-14-10(16)8(18-11(14)17)4-5-2-6(12)9(15)7(13)3-5;2-1-3/h2-4,15H,1H3;/b8-4-; |
| InChIKey | HRNOHKZVAXXLIE-ZYFYRQFPSA-N |
| XLogP | 2.95 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|