C10H11N3Pt — CID 158567715
5,9-dimethyl-2,5,9-triaza-7λ4-platinatricyclo[6.4.0.02,6]dodeca-1(12),3,6,7,10-pentaene (PubChem CID 158567715) has the molecular formula C10H11N3Pt and a molecular weight of 368.30 g/mol. Its IUPAC name is 5,9-dimethyl-2,5,9-triaza-7λ4-platinatricyclo[6.4.0.02,6]dodeca-1(12),3,6,7,10-pentaene.
| Compound Name | 5,9-dimethyl-2,5,9-triaza-7λ4-platinatricyclo[6.4.0.02,6]dodeca-1(12),3,6,7,10-pentaene |
|---|---|
| PubChem CID | 158567715 |
| Molecular Formula | C10H11N3Pt |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 5,9-dimethyl-2,5,9-triaza-7λ4-platinatricyclo[6.4.0.02,6]dodeca-1(12),3,6,7,10-pentaene |
| SMILES | CN1C=CC=C2C1=[Pt]=C1N(C)C=CN21 |
| InChI | InChI=1S/C10H11N3.Pt/c1-11-5-3-4-10(8-11)13-7-6-12(2)9-13;/h3-7H,1-2H3; |
| InChIKey | PLOBTIAFMNTIIX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |