C3H20N4Si4 — CID 158568331
N'-(2,2-dimethylhydrazinyl)silyl-N,N,N'-trisilylmethanediamine (PubChem CID 158568331) has the molecular formula C3H20N4Si4 and a molecular weight of 224.56 g/mol. Its IUPAC name is N'-(2,2-dimethylhydrazinyl)silyl-N,N,N'-trisilylmethanediamine.
| Compound Name | N'-(2,2-dimethylhydrazinyl)silyl-N,N,N'-trisilylmethanediamine |
|---|---|
| PubChem CID | 158568331 |
| Molecular Formula | C3H20N4Si4 |
| Molecular Weight | 224.56 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N'-(2,2-dimethylhydrazinyl)silyl-N,N,N'-trisilylmethanediamine |
| SMILES | CN(C)N[SiH2]N([SiH3])CN([SiH3])[SiH3] |
| InChI | InChI=1S/C3H20N4Si4/c1-5(2)4-11-7(10)3-6(8)9/h4H,3,11H2,1-2,8-10H3 |
| InChIKey | HRTLRXHEBOAHPU-UHFFFAOYSA-N |
| XLogP | -5.55 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.56 |
| LogP ≤ 5 | -5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|