C27H34O7 — CID 158568782
4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 158568782) has the molecular formula C27H34O7 and a molecular weight of 470.56 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158568782 |
| Molecular Formula | C27H34O7 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOC(=O)C(=C)C.CC(C)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H16O2.C12H18O5/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;1-9(2)11(13)16-7-5-15-6-8-17-12(14)10(3)4/h3-10,16-17H,1-2H3;1,3,5-8H2,2,4H3 |
| InChIKey | HRUXXJDHBCEIDR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|