C33H35NO9 — CID 158569152
ethyl 2-[2-(1,3-dioxolan-2-yl)phenyl]-2-oxoacetate;ethyl (Z)-2-[2-(1,3-dioxolan-2-yl)phenyl]-4-pyridin-2-ylbut-2-enoate (PubChem CID 158569152) has the molecular formula C33H35NO9 and a molecular weight of 589.64 g/mol. Its IUPAC name is ethyl 2-[2-(1,3-dioxolan-2-yl)phenyl]-2-oxoacetate;ethyl (Z)-2-[2-(1,3-dioxolan-2-yl)phenyl]-4-pyridin-2-ylbut-2-enoate.
| Compound Name | ethyl 2-[2-(1,3-dioxolan-2-yl)phenyl]-2-oxoacetate;ethyl (Z)-2-[2-(1,3-dioxolan-2-yl)phenyl]-4-pyridin-2-ylbut-2-enoate |
|---|---|
| PubChem CID | 158569152 |
| Molecular Formula | C33H35NO9 |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | ethyl 2-[2-(1,3-dioxolan-2-yl)phenyl]-2-oxoacetate;ethyl (Z)-2-[2-(1,3-dioxolan-2-yl)phenyl]-4-pyridin-2-ylbut-2-enoate |
| SMILES | CCOC(=O)/C(=C\Cc1ccccn1)c1ccccc1C1OCCO1.CCOC(=O)C(=O)c1ccccc1C1OCCO1 |
| InChI | InChI=1S/C20H21NO4.C13H14O5/c1-2-23-19(22)17(11-10-15-7-5-6-12-21-15)16-8-3-4-9-18(16)20-24-13-14-25-20;1-2-16-12(15)11(14)9-5-3-4-6-10(9)13-17-7-8-18-13/h3-9,11-12,20H,2,10,13-14H2,1H3;3-6,13H,2,7-8H2,1H3/b17-11-; |
| InChIKey | HRWDEWMTQVYHJI-CULRIWENSA-N |
| XLogP | 4.79 |
| TPSA | 119.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|