C22H38O3 — CID 158569182
1-hydroxybutan-2-yl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 158569182) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is 1-hydroxybutan-2-yl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | 1-hydroxybutan-2-yl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 158569182 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | 1-hydroxybutan-2-yl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(CC)CO |
| InChI | InChI=1S/C22H38O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(24)25-21(4-2)20-23/h5-6,8-9,11-12,21,23H,3-4,7,10,13-20H2,1-2H3/b6-5-,9-8-,12-11- |
| InChIKey | LGRFDKAAZPLGTB-AGRJPVHOSA-N |
| XLogP | 5.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|