5-oxopentane-1,1,3-tricarboxylic acid

C8H10O7 — CID 158569860

IUPAC5-oxopentane-1,1,3-tricarboxylic acid
SMILESO=CCC(CC(C(=O)O)C(=O)O)C(=O)O
InChIInChI=1S/C8H10O7/c9-2-1-4(6(10)11)3-5(7(12)13)8(14)15/h2,4-5H,1,3H2,(H,10,11)(H,12,13)(H,14,15)
InChIKeyOSFNDDHGRJRQEY-UHFFFAOYSA-N
MW218.16 g/mol
LogP-0.55
Rot. Bonds7

About 5-oxopentane-1,1,3-tricarboxylic acid

5-oxopentane-1,1,3-tricarboxylic acid (PubChem CID 158569860) has the molecular formula C8H10O7 and a molecular weight of 218.16 g/mol. Its IUPAC name is 5-oxopentane-1,1,3-tricarboxylic acid.

Molecular Properties

Compound Name5-oxopentane-1,1,3-tricarboxylic acid
PubChem CID158569860
Molecular FormulaC8H10O7
Molecular Weight218.16 g/mol
Exact Mass218.04
IUPAC Name5-oxopentane-1,1,3-tricarboxylic acid
SMILESO=CCC(CC(C(=O)O)C(=O)O)C(=O)O
InChIInChI=1S/C8H10O7/c9-2-1-4(6(10)11)3-5(7(12)13)8(14)15/h2,4-5H,1,3H2,(H,10,11)(H,12,13)(H,14,15)
InChIKeyOSFNDDHGRJRQEY-UHFFFAOYSA-N
XLogP-0.55
TPSA128.97 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.16
LogP ≤ 5-0.55
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 5-oxopentane-1,1,3-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-hydroxybutane-1,1,3-tricarboxylic acid
CID 123239997
2-(2-methoxyethyl)-4-oxobutanoic acid
CID 141105257
(2R)-2-methyl-4-oxobutanoic acid
CID 76936806
3-(1,4-dioxopentan-3-ylsulfanyl)-4-oxopentanal
CID 102082166
4-oxo-2-(2-oxoethyl)but-3-enoic acid
CID 174726146
ethane;(E)-2-(2-oxoethyl)hex-4-enoic acid;toluene
CID 143876602
(4R)-5-methyl-4-(2-oxoethyl)hex-5-enoic acid
CID 122408291
2-formyl-3-(2-oxoethyl)hex-4-enoic acid
CID 151152838
3-hydroxypropane-1,1,3-tricarboxylic acid
CID 150529276
2-amino-3-methyl-5-oxopentanoic acid
CID 22594684
(1-acetyloxy-3-oxopropyl) acetate
CID 88624567
4-oxo-2-(propan-2-ylamino)butanoic acid
CID 142578702

Frequently Asked Questions

What is the IUPAC name of 5-oxopentane-1,1,3-tricarboxylic acid?
The IUPAC name of 5-oxopentane-1,1,3-tricarboxylic acid (CID 158569860) is 5-oxopentane-1,1,3-tricarboxylic acid.
What is the SMILES notation for 5-oxopentane-1,1,3-tricarboxylic acid?
The canonical SMILES for 5-oxopentane-1,1,3-tricarboxylic acid is O=CCC(CC(C(=O)O)C(=O)O)C(=O)O.
What is the InChIKey of 5-oxopentane-1,1,3-tricarboxylic acid?
The InChIKey is OSFNDDHGRJRQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O7/c9-2-1-4(6(10)11)3-5(7(12)13)8(14)15/h2,4-5H,1,3H2,(H,10,11)(H,12,13)(H,14,15).
What are the key properties of 5-oxopentane-1,1,3-tricarboxylic acid?
5-oxopentane-1,1,3-tricarboxylic acid has a molecular weight of 218.16 g/mol, XLogP of -0.55, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxopentane-1,1,3-tricarboxylic acid is sourced from PubChem (CID 158569860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).