C39H35ClN2O8 — CID 158570272
4-[3-[4-(2-acetyl-5-chlorophenyl)-5-methoxy-2-oxo-1-pyridinyl]-4-(4-methylphenyl)-2-oxobutyl]benzoic acid;4-aminobenzoic acid (PubChem CID 158570272) has the molecular formula C39H35ClN2O8 and a molecular weight of 695.17 g/mol. Its IUPAC name is 4-[3-[4-(2-acetyl-5-chlorophenyl)-5-methoxy-2-oxo-1-pyridinyl]-4-(4-methylphenyl)-2-oxobutyl]benzoic acid;4-aminobenzoic acid.
| Compound Name | 4-[3-[4-(2-acetyl-5-chlorophenyl)-5-methoxy-2-oxo-1-pyridinyl]-4-(4-methylphenyl)-2-oxobutyl]benzoic acid;4-aminobenzoic acid |
|---|---|
| PubChem CID | 158570272 |
| Molecular Formula | C39H35ClN2O8 |
| Molecular Weight | 695.17 g/mol |
| Exact Mass | 694.21 |
| IUPAC Name | 4-[3-[4-(2-acetyl-5-chlorophenyl)-5-methoxy-2-oxo-1-pyridinyl]-4-(4-methylphenyl)-2-oxobutyl]benzoic acid;4-aminobenzoic acid |
| SMILES | COc1cn(C(Cc2ccc(C)cc2)C(=O)Cc2ccc(C(=O)O)cc2)c(=O)cc1-c1cc(Cl)ccc1C(C)=O.Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H28ClNO6.C7H7NO2/c1-19-4-6-21(7-5-19)14-28(29(36)15-22-8-10-23(11-9-22)32(38)39)34-18-30(40-3)27(17-31(34)37)26-16-24(33)12-13-25(26)20(2)35;8-6-3-1-5(2-4-6)7(9)10/h4-13,16-18,28H,14-15H2,1-3H3,(H,38,39);1-4H,8H2,(H,9,10) |
| InChIKey | HRZLQJYTNVNGOR-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 165.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.17 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|