C28H32N2O4 — CID 158570472
benzene-1,4-diamine;2,5-dimethylbenzene-1,4-diol;5-(3-hydroxy-4-methylphenyl)-2-methylphenol (PubChem CID 158570472) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is benzene-1,4-diamine;2,5-dimethylbenzene-1,4-diol;5-(3-hydroxy-4-methylphenyl)-2-methylphenol.
| Compound Name | benzene-1,4-diamine;2,5-dimethylbenzene-1,4-diol;5-(3-hydroxy-4-methylphenyl)-2-methylphenol |
|---|---|
| PubChem CID | 158570472 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | benzene-1,4-diamine;2,5-dimethylbenzene-1,4-diol;5-(3-hydroxy-4-methylphenyl)-2-methylphenol |
| SMILES | Cc1cc(O)c(C)cc1O.Cc1ccc(-c2ccc(C)c(O)c2)cc1O.Nc1ccc(N)cc1 |
| InChI | InChI=1S/C14H14O2.C8H10O2.C6H8N2/c1-9-3-5-11(7-13(9)15)12-6-4-10(2)14(16)8-12;1-5-3-8(10)6(2)4-7(5)9;7-5-1-2-6(8)4-3-5/h3-8,15-16H,1-2H3;3-4,9-10H,1-2H3;1-4H,7-8H2 |
| InChIKey | HSAAOZXIYGNKLI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|