About 5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione
5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione (PubChem CID 15857128) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is 5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione |
| PubChem CID | 15857128 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2c(c(=O)[nH]1)CCc1ccccc1-2 |
| InChI | InChI=1S/C12H10N2O2/c15-11-9-6-5-7-3-1-2-4-8(7)10(9)13-12(16)14-11/h1-4H,5-6H2,(H2,13,14,15,16) |
| InChIKey | SGRJMNANKWHMBS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione?
The IUPAC name of 5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione (CID 15857128) is 5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione.
What is the SMILES notation for 5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione?
The canonical SMILES for 5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione is O=c1[nH]c2c(c(=O)[nH]1)CCc1ccccc1-2.
What is the InChIKey of 5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione?
The InChIKey is SGRJMNANKWHMBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c15-11-9-6-5-7-3-1-2-4-8(7)10(9)13-12(16)14-11/h1-4H,5-6H2,(H2,13,14,15,16).
What are the key properties of 5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione?
5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione has a molecular weight of 214.22 g/mol, XLogP of 0.83, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-1H-benzo[h]quinazoline-2,4-dione is sourced from PubChem (CID 15857128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).