About 1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium
1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium (PubChem CID 158572007) has the molecular formula C19H33N2OY+
and a molecular weight of 394.39 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium.
Molecular Properties
| Compound Name | 1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium |
| PubChem CID | 158572007 |
| Molecular Formula | C19H33N2OY+ |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium |
| SMILES | CCN1CCC[N+](C)(CCOc2c(C)cccc2C)CCC1.[Y] |
| InChI | InChI=1S/C19H33N2O.Y/c1-5-20-11-7-13-21(4,14-8-12-20)15-16-22-19-17(2)9-6-10-18(19)3;/h6,9-10H,5,7-8,11-16H2,1-4H3;/q+1; |
| InChIKey | CJUALSMGLQUEMW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium?
The IUPAC name of 1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium (CID 158572007) is 1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium.
What is the SMILES notation for 1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium?
The canonical SMILES for 1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium is CCN1CCC[N+](C)(CCOc2c(C)cccc2C)CCC1.[Y].
What is the InChIKey of 1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium?
The InChIKey is CJUALSMGLQUEMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33N2O.Y/c1-5-20-11-7-13-21(4,14-8-12-20)15-16-22-19-17(2)9-6-10-18(19)3;/h6,9-10H,5,7-8,11-16H2,1-4H3;/q+1;.
What are the key properties of 1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium?
1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium has a molecular weight of 394.39 g/mol, XLogP of 3.24, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,6-dimethylphenoxy)ethyl]-5-ethyl-1-methyl-1,5-diazocan-1-ium;yttrium is sourced from PubChem (CID 158572007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).