C29H33F3O6S3 — CID 158573289
3-(benzenesulfonyloxy)-1,1,2-trifluoropropane-1-sulfonate;dibenzyl(cyclohexyl)sulfanium (PubChem CID 158573289) has the molecular formula C29H33F3O6S3 and a molecular weight of 630.77 g/mol. Its IUPAC name is 3-(benzenesulfonyloxy)-1,1,2-trifluoropropane-1-sulfonate;dibenzyl(cyclohexyl)sulfanium.
| Compound Name | 3-(benzenesulfonyloxy)-1,1,2-trifluoropropane-1-sulfonate;dibenzyl(cyclohexyl)sulfanium |
|---|---|
| PubChem CID | 158573289 |
| Molecular Formula | C29H33F3O6S3 |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | 3-(benzenesulfonyloxy)-1,1,2-trifluoropropane-1-sulfonate;dibenzyl(cyclohexyl)sulfanium |
| SMILES | O=S(=O)(OCC(F)C(F)(F)S(=O)(=O)[O-])c1ccccc1.c1ccc(C[S+](Cc2ccccc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H25S.C9H9F3O6S2/c1-4-10-18(11-5-1)16-21(20-14-8-3-9-15-20)17-19-12-6-2-7-13-19;10-8(9(11,12)20(15,16)17)6-18-19(13,14)7-4-2-1-3-5-7/h1-2,4-7,10-13,20H,3,8-9,14-17H2;1-5,8H,6H2,(H,15,16,17)/q+1;/p-1 |
| InChIKey | HSIPPGWMUTULSR-UHFFFAOYSA-M |
| XLogP | 6.21 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|