C34H49BCl2N2O11 — CID 158573768
CID 158573768 (PubChem CID 158573768) has the molecular formula C34H49BCl2N2O11 and a molecular weight of 743.49 g/mol.
| Compound Name | CID 158573768 |
|---|---|
| PubChem CID | 158573768 |
| Molecular Formula | C34H49BCl2N2O11 |
| Molecular Weight | 743.49 g/mol |
| Exact Mass | 742.28 |
| IUPAC Name | — |
| SMILES | C[C@@]12OC(=O)[C@]1([C@@H](O)[C@H]1CCCC(O)C1)NC(=O)[C@@H]2CCCl.C[C@@]12OC(=O)[C@]1([C@@H](O)[C@H]1CCCC3OC31)NC(=O)[C@@H]2CCCl.[B]C1CCCO1 |
| InChI | InChI=1S/C15H20ClNO5.C15H22ClNO5.C4H7BO/c1-14-8(5-6-16)12(19)17-15(14,13(20)22-14)11(18)7-3-2-4-9-10(7)21-9;1-14-10(5-6-16)12(20)17-15(14,13(21)22-14)11(19)8-3-2-4-9(18)7-8;5-4-2-1-3-6-4/h7-11,18H,2-6H2,1H3,(H,17,19);8-11,18-19H,2-7H2,1H3,(H,17,20);4H,1-3H2/t7-,8-,9?,10?,11-,14-,15-;8-,9?,10-,11-,14-,15-;/m00./s1 |
| InChIKey | TZAHRKJNKBFKSB-JZHHGGDISA-N |
| XLogP | 0.96 |
| TPSA | 193.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.49 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|