About CID 158574080
CID 158574080 (PubChem CID 158574080) has the molecular formula C34H41BClN8O2
and a molecular weight of 640.02 g/mol.
Molecular Properties
| Compound Name | CID 158574080 |
| PubChem CID | 158574080 |
| Molecular Formula | C34H41BClN8O2 |
| Molecular Weight | 640.02 g/mol |
| Exact Mass | 639.31 |
| IUPAC Name | — |
| SMILES | Cc1c(Cl)nc2c(c1C)N1CC[C@@H](C1)N2.Cc1cc(-c2nc3c(c(C)c2C)N2CC[C@@H](C2)N3)ccn1.Cc1cc(O[B]O)ccn1 |
| InChI | InChI=1S/C17H20N4.C11H14ClN3.C6H7BNO2/c1-10-8-13(4-6-18-10)15-11(2)12(3)16-17(20-15)19-14-5-7-21(16)9-14;1-6-7(2)10(12)14-11-9(6)15-4-3-8(5-15)13-11;1-5-4-6(10-7-9)2-3-8-5/h4,6,8,14H,5,7,9H2,1-3H3,(H,19,20);8H,3-5H2,1-2H3,(H,13,14);2-4,9H,1H3/t14-;8-;/m00./s1 |
| InChIKey | JKWBLFHIIMWCQE-SFFVXIAHSA-N |
| XLogP | 5.72 |
| TPSA | 111.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 640.02 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158574080 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158574080?
The IUPAC name of CID 158574080 (CID 158574080) is not available.
What is the SMILES notation for CID 158574080?
The canonical SMILES for CID 158574080 is Cc1c(Cl)nc2c(c1C)N1CC[C@@H](C1)N2.Cc1cc(-c2nc3c(c(C)c2C)N2CC[C@@H](C2)N3)ccn1.Cc1cc(O[B]O)ccn1.
What is the InChIKey of CID 158574080?
The InChIKey is JKWBLFHIIMWCQE-SFFVXIAHSA-N. The full InChI is InChI=1S/C17H20N4.C11H14ClN3.C6H7BNO2/c1-10-8-13(4-6-18-10)15-11(2)12(3)16-17(20-15)19-14-5-7-21(16)9-14;1-6-7(2)10(12)14-11-9(6)15-4-3-8(5-15)13-11;1-5-4-6(10-7-9)2-3-8-5/h4,6,8,14H,5,7,9H2,1-3H3,(H,19,20);8H,3-5H2,1-2H3,(H,13,14);2-4,9H,1H3/t14-;8-;/m00./s1.
What are the key properties of CID 158574080?
CID 158574080 has a molecular weight of 640.02 g/mol, XLogP of 5.72, 3 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158574080 is sourced from PubChem (CID 158574080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).