About [bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate
[bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate (PubChem CID 15857567) has the molecular formula C24H13F12NO3S
and a molecular weight of 623.42 g/mol. Its IUPAC name is [bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate |
| PubChem CID | 15857567 |
| Molecular Formula | C24H13F12NO3S |
| Molecular Weight | 623.42 g/mol |
| Exact Mass | 623.04 |
| IUPAC Name | [bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON=C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H13F12NO3S/c1-12-2-4-19(5-3-12)41(38,39)40-37-20(13-6-15(21(25,26)27)10-16(7-13)22(28,29)30)14-8-17(23(31,32)33)11-18(9-14)24(34,35)36/h2-11H,1H3 |
| InChIKey | DQEBMLMHANGSTP-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 623.42 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate?
The IUPAC name of [bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate (CID 15857567) is [bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate.
What is the SMILES notation for [bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate?
The canonical SMILES for [bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)ON=C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1.
What is the InChIKey of [bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate?
The InChIKey is DQEBMLMHANGSTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H13F12NO3S/c1-12-2-4-19(5-3-12)41(38,39)40-37-20(13-6-15(21(25,26)27)10-16(7-13)22(28,29)30)14-8-17(23(31,32)33)11-18(9-14)24(34,35)36/h2-11H,1H3.
What are the key properties of [bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate?
[bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate has a molecular weight of 623.42 g/mol, XLogP of 8.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [bis[3,5-bis(trifluoromethyl)phenyl]methylideneamino] 4-methylbenzenesulfonate is sourced from PubChem (CID 15857567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).