C29H16F6N2O2S2 — CID 15857720
2-[4-[2-[5-(1,3-benzoxazol-2-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-1,3-benzoxazole (PubChem CID 15857720) has the molecular formula C29H16F6N2O2S2 and a molecular weight of 602.58 g/mol. Its IUPAC name is 2-[4-[2-[5-(1,3-benzoxazol-2-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-1,3-benzoxazole.
| Compound Name | 2-[4-[2-[5-(1,3-benzoxazol-2-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 15857720 |
| Molecular Formula | C29H16F6N2O2S2 |
| Molecular Weight | 602.58 g/mol |
| Exact Mass | 602.06 |
| IUPAC Name | 2-[4-[2-[5-(1,3-benzoxazol-2-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-1,3-benzoxazole |
| SMILES | Cc1sc(-c2nc3ccccc3o2)cc1C1=C(c2cc(-c3nc4ccccc4o3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C29H16F6N2O2S2/c1-13-15(11-21(40-13)25-36-17-7-3-5-9-19(17)38-25)23-24(28(32,33)29(34,35)27(23,30)31)16-12-22(41-14(16)2)26-37-18-8-4-6-10-20(18)39-26/h3-12H,1-2H3 |
| InChIKey | IUVVQAIRKWRKIP-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.58 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|