C5H11N3+2 — CID 15857733
1,2,4-trimethyl-1,2,4-triazole-2,4-diium (PubChem CID 15857733) has the molecular formula C5H11N3+2 and a molecular weight of 113.16 g/mol. Its IUPAC name is 1,2,4-trimethyl-1,2,4-triazole-2,4-diium.
| Compound Name | 1,2,4-trimethyl-1,2,4-triazole-2,4-diium |
|---|---|
| PubChem CID | 15857733 |
| Molecular Formula | C5H11N3+2 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.09 |
| IUPAC Name | 1,2,4-trimethyl-1,2,4-triazole-2,4-diium |
| SMILES | Cn1c[n+](C)c[n+]1C |
| InChI | InChI=1S/C5H11N3/c1-6-4-7(2)8(3)5-6/h4-5H,1-3H3/q+2 |
| InChIKey | RUBPGYPADMRCQI-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 12.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|