About 2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine
2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine (PubChem CID 158577824) has the molecular formula C9H11BO2
and a molecular weight of 162.00 g/mol. Its IUPAC name is 2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine.
Molecular Properties
| Compound Name | 2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine |
| PubChem CID | 158577824 |
| Molecular Formula | C9H11BO2 |
| Molecular Weight | 162.00 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine |
| SMILES | Cc1cccc2c1OB(O)CC2 |
| InChI | InChI=1S/C9H11BO2/c1-7-3-2-4-8-5-6-10(11)12-9(7)8/h2-4,11H,5-6H2,1H3 |
| InChIKey | SDMUOMGOLVWZNY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.00 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine?
The IUPAC name of 2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine (CID 158577824) is 2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine.
What is the SMILES notation for 2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine?
The canonical SMILES for 2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine is Cc1cccc2c1OB(O)CC2.
What is the InChIKey of 2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine?
The InChIKey is SDMUOMGOLVWZNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BO2/c1-7-3-2-4-8-5-6-10(11)12-9(7)8/h2-4,11H,5-6H2,1H3.
What are the key properties of 2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine?
2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine has a molecular weight of 162.00 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinine is sourced from PubChem (CID 158577824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).