C32H30F2N4O4S — CID 158578253
1-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-fluorophenyl)pentane-2,4-dione (PubChem CID 158578253) has the molecular formula C32H30F2N4O4S and a molecular weight of 604.68 g/mol. Its IUPAC name is 1-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-fluorophenyl)pentane-2,4-dione.
| Compound Name | 1-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-fluorophenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 158578253 |
| Molecular Formula | C32H30F2N4O4S |
| Molecular Weight | 604.68 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | 1-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-fluorophenyl)pentane-2,4-dione |
| SMILES | COCCNCc1cnc(-c2cc3nccc(Oc4ccc(CC(=O)CC(=O)Cc5ccccc5F)cc4F)c3s2)n1C |
| InChI | InChI=1S/C32H30F2N4O4S/c1-38-22(18-35-11-12-41-2)19-37-32(38)30-17-27-31(43-30)29(9-10-36-27)42-28-8-7-20(14-26(28)34)13-23(39)16-24(40)15-21-5-3-4-6-25(21)33/h3-10,14,17,19,35H,11-13,15-16,18H2,1-2H3 |
| InChIKey | VFBURUAWBXEAJV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.68 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|