C33H33FN4O4S — CID 158578254
1-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(4-methylphenyl)pentane-2,4-dione (PubChem CID 158578254) has the molecular formula C33H33FN4O4S and a molecular weight of 600.72 g/mol. Its IUPAC name is 1-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(4-methylphenyl)pentane-2,4-dione.
| Compound Name | 1-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(4-methylphenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 158578254 |
| Molecular Formula | C33H33FN4O4S |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | 1-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(4-methylphenyl)pentane-2,4-dione |
| SMILES | COCCNCc1cnc(-c2cc3nccc(Oc4ccc(CC(=O)CC(=O)Cc5ccc(C)cc5)cc4F)c3s2)n1C |
| InChI | InChI=1S/C33H33FN4O4S/c1-21-4-6-22(7-5-21)14-25(39)17-26(40)15-23-8-9-29(27(34)16-23)42-30-10-11-36-28-18-31(43-32(28)30)33-37-20-24(38(33)2)19-35-12-13-41-3/h4-11,16,18,20,35H,12-15,17,19H2,1-3H3 |
| InChIKey | KLDAQBKZZGRBMX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|