C45H35N3 — CID 158578907
2,4-dipyridin-3-yl-6-[3-(3-spiro[cyclohexane-1,9'-fluorene]-2'-ylphenyl)phenyl]pyridine (PubChem CID 158578907) has the molecular formula C45H35N3 and a molecular weight of 617.80 g/mol. Its IUPAC name is 2,4-dipyridin-3-yl-6-[3-(3-spiro[cyclohexane-1,9'-fluorene]-2'-ylphenyl)phenyl]pyridine.
| Compound Name | 2,4-dipyridin-3-yl-6-[3-(3-spiro[cyclohexane-1,9'-fluorene]-2'-ylphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 158578907 |
| Molecular Formula | C45H35N3 |
| Molecular Weight | 617.80 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | 2,4-dipyridin-3-yl-6-[3-(3-spiro[cyclohexane-1,9'-fluorene]-2'-ylphenyl)phenyl]pyridine |
| SMILES | c1cncc(-c2cc(-c3cccnc3)nc(-c3cccc(-c4cccc(-c5ccc6c(c5)C5(CCCCC5)c5ccccc5-6)c4)c3)c2)c1 |
| InChI | InChI=1S/C45H35N3/c1-4-20-45(21-5-1)41-17-3-2-16-39(41)40-19-18-34(26-42(40)45)32-11-6-10-31(24-32)33-12-7-13-35(25-33)43-27-38(36-14-8-22-46-29-36)28-44(48-43)37-15-9-23-47-30-37/h2-3,6-19,22-30H,1,4-5,20-21H2 |
| InChIKey | UVMXLKRCIIJNNF-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.80 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |