C28H37BrN2O4 — CID 158580194
N-[2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-yl]formamide;N-[4-hydroxy-2,3,6-trimethyl-5-(2-methylprop-2-enyl)phenyl]formamide (PubChem CID 158580194) has the molecular formula C28H37BrN2O4 and a molecular weight of 545.52 g/mol. Its IUPAC name is N-[2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-yl]formamide;N-[4-hydroxy-2,3,6-trimethyl-5-(2-methylprop-2-enyl)phenyl]formamide.
| Compound Name | N-[2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-yl]formamide;N-[4-hydroxy-2,3,6-trimethyl-5-(2-methylprop-2-enyl)phenyl]formamide |
|---|---|
| PubChem CID | 158580194 |
| Molecular Formula | C28H37BrN2O4 |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | N-[2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-yl]formamide;N-[4-hydroxy-2,3,6-trimethyl-5-(2-methylprop-2-enyl)phenyl]formamide |
| SMILES | C=C(C)Cc1c(C)c(NC=O)c(C)c(C)c1O.Cc1c(C)c2c(c(C)c1NC=O)CC(C)(CBr)O2 |
| InChI | InChI=1S/C14H18BrNO2.C14H19NO2/c1-8-9(2)13-11(5-14(4,6-15)18-13)10(3)12(8)16-7-17;1-8(2)6-12-11(5)13(15-7-16)9(3)10(4)14(12)17/h7H,5-6H2,1-4H3,(H,16,17);7,17H,1,6H2,2-5H3,(H,15,16) |
| InChIKey | HTDSQIVCLBYKEV-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|