C23H32NO14P3S — CID 158580592
[2-(4-ethyl-2-nitro-5-phenylsulfanylphenyl)propoxy-hydroxyphosphoryl] [hydroxy-[[(2R,5S)-3-hydroxy-5-methyloxolan-2-yl]methoxy]phosphoryl] hydrogen phosphate (PubChem CID 158580592) has the molecular formula C23H32NO14P3S and a molecular weight of 671.49 g/mol. Its IUPAC name is [2-(4-ethyl-2-nitro-5-phenylsulfanylphenyl)propoxy-hydroxyphosphoryl] [hydroxy-[[(2R,5S)-3-hydroxy-5-methyloxolan-2-yl]methoxy]phosphoryl] hydrogen phosphate.
| Compound Name | [2-(4-ethyl-2-nitro-5-phenylsulfanylphenyl)propoxy-hydroxyphosphoryl] [hydroxy-[[(2R,5S)-3-hydroxy-5-methyloxolan-2-yl]methoxy]phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 158580592 |
| Molecular Formula | C23H32NO14P3S |
| Molecular Weight | 671.49 g/mol |
| Exact Mass | 671.08 |
| IUPAC Name | [2-(4-ethyl-2-nitro-5-phenylsulfanylphenyl)propoxy-hydroxyphosphoryl] [hydroxy-[[(2R,5S)-3-hydroxy-5-methyloxolan-2-yl]methoxy]phosphoryl] hydrogen phosphate |
| SMILES | CCc1cc([N+](=O)[O-])c(C(C)COP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](C)CC2O)cc1Sc1ccccc1 |
| InChI | InChI=1S/C23H32NO14P3S/c1-4-17-11-20(24(26)27)19(12-23(17)42-18-8-6-5-7-9-18)15(2)13-34-39(28,29)37-41(32,33)38-40(30,31)35-14-22-21(25)10-16(3)36-22/h5-9,11-12,15-16,21-22,25H,4,10,13-14H2,1-3H3,(H,28,29)(H,30,31)(H,32,33)/t15?,16-,21?,22+/m0/s1 |
| InChIKey | HTFAINGCHDNSRO-ZEDYHNJOSA-N |
| XLogP | 5.32 |
| TPSA | 221.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|