About 1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol
1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol (PubChem CID 158581006) has the molecular formula C14H23NO3
and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol.
Molecular Properties
| Compound Name | 1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol |
| PubChem CID | 158581006 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol |
| SMILES | CO.OCC1CN(Cc2ccccc2)CCC1O |
| InChI | InChI=1S/C13H19NO2.CH4O/c15-10-12-9-14(7-6-13(12)16)8-11-4-2-1-3-5-11;1-2/h1-5,12-13,15-16H,6-10H2;2H,1H3 |
| InChIKey | HTGDTQVZEPGLDF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol?
The IUPAC name of 1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol (CID 158581006) is 1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol.
What is the SMILES notation for 1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol?
The canonical SMILES for 1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol is CO.OCC1CN(Cc2ccccc2)CCC1O.
What is the InChIKey of 1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol?
The InChIKey is HTGDTQVZEPGLDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2.CH4O/c15-10-12-9-14(7-6-13(12)16)8-11-4-2-1-3-5-11;1-2/h1-5,12-13,15-16H,6-10H2;2H,1H3.
What are the key properties of 1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol?
1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol has a molecular weight of 253.34 g/mol, XLogP of 0.47, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-(hydroxymethyl)piperidin-4-ol;methanol is sourced from PubChem (CID 158581006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).