About benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate
benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate (PubChem CID 15858119) has the molecular formula C31H26N2O5
and a molecular weight of 506.56 g/mol. Its IUPAC name is benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate.
Molecular Properties
| Compound Name | benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate |
| PubChem CID | 15858119 |
| Molecular Formula | C31H26N2O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate |
| SMILES | O=C(OCc1ccccc1)N(C(=O)OCc1ccccc1)[C@@H]1C(=O)N(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C31H26N2O5/c34-29-28(27(25-17-9-3-10-18-25)32(29)26-19-11-4-12-20-26)33(30(35)37-21-23-13-5-1-6-14-23)31(36)38-22-24-15-7-2-8-16-24/h1-20,27-28H,21-22H2/t27-,28+/m1/s1 |
| InChIKey | JPLHZMOJFIRXFN-IZLXSDGUSA-N |
| XLogP | 6.12 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate?
The IUPAC name of benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate (CID 15858119) is benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate.
What is the SMILES notation for benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate?
The canonical SMILES for benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate is O=C(OCc1ccccc1)N(C(=O)OCc1ccccc1)[C@@H]1C(=O)N(c2ccccc2)[C@@H]1c1ccccc1.
What is the InChIKey of benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate?
The InChIKey is JPLHZMOJFIRXFN-IZLXSDGUSA-N. The full InChI is InChI=1S/C31H26N2O5/c34-29-28(27(25-17-9-3-10-18-25)32(29)26-19-11-4-12-20-26)33(30(35)37-21-23-13-5-1-6-14-23)31(36)38-22-24-15-7-2-8-16-24/h1-20,27-28H,21-22H2/t27-,28+/m1/s1.
What are the key properties of benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate?
benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate has a molecular weight of 506.56 g/mol, XLogP of 6.12, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]-N-phenylmethoxycarbonylcarbamate is sourced from PubChem (CID 15858119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).