About acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate
acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate (PubChem CID 158581609) has the molecular formula C13H25N5O
and a molecular weight of 267.38 g/mol. Its IUPAC name is acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate.
Molecular Properties
| Compound Name | acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate |
| PubChem CID | 158581609 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate |
| SMILES | CC#N.NCCc1ccnc(CCN)c1CCN.O |
| InChI | InChI=1S/C11H20N4.C2H3N.H2O/c12-5-1-9-4-8-15-11(3-7-14)10(9)2-6-13;1-2-3;/h4,8H,1-3,5-7,12-14H2;1H3;1H2 |
| InChIKey | ZQIGHSYGJKIZSQ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 146.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate?
The IUPAC name of acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate (CID 158581609) is acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate.
What is the SMILES notation for acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate?
The canonical SMILES for acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate is CC#N.NCCc1ccnc(CCN)c1CCN.O.
What is the InChIKey of acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate?
The InChIKey is ZQIGHSYGJKIZSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4.C2H3N.H2O/c12-5-1-9-4-8-15-11(3-7-14)10(9)2-6-13;1-2-3;/h4,8H,1-3,5-7,12-14H2;1H3;1H2.
What are the key properties of acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate?
acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate has a molecular weight of 267.38 g/mol, XLogP of -0.71, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2-[2,3-bis(2-aminoethyl)-4-pyridinyl]ethanamine;hydrate is sourced from PubChem (CID 158581609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).