About 2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine
2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine (PubChem CID 158581624) has the molecular formula C26H24N4
and a molecular weight of 392.51 g/mol. Its IUPAC name is 2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine.
Molecular Properties
| Compound Name | 2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine |
| PubChem CID | 158581624 |
| Molecular Formula | C26H24N4 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine |
| SMILES | Cc1ccc2ccc3ccc(C)nc3c2n1.Cc1ccnc(-c2cc(C)ccn2)c1 |
| InChI | InChI=1S/C14H12N2.C12H12N2/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;1-9-3-5-13-11(7-9)12-8-10(2)4-6-14-12/h3-8H,1-2H3;3-8H,1-2H3 |
| InChIKey | HTHZGGWUKPYJET-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine?
The IUPAC name of 2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine (CID 158581624) is 2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine.
What is the SMILES notation for 2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine?
The canonical SMILES for 2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine is Cc1ccc2ccc3ccc(C)nc3c2n1.Cc1ccnc(-c2cc(C)ccn2)c1.
What is the InChIKey of 2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine?
The InChIKey is HTHZGGWUKPYJET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2.C12H12N2/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;1-9-3-5-13-11(7-9)12-8-10(2)4-6-14-12/h3-8H,1-2H3;3-8H,1-2H3.
What are the key properties of 2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine?
2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine has a molecular weight of 392.51 g/mol, XLogP of 6.16, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-dimethyl-1,10-phenanthroline;4-methyl-2-(4-methyl-2-pyridinyl)pyridine is sourced from PubChem (CID 158581624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).