About hydrazine;methylurea
hydrazine;methylurea (PubChem CID 158581810) has the molecular formula C2H10N4O
and a molecular weight of 106.13 g/mol. Its IUPAC name is hydrazine;methylurea.
Molecular Properties
| Compound Name | hydrazine;methylurea |
| PubChem CID | 158581810 |
| Molecular Formula | C2H10N4O |
| Molecular Weight | 106.13 g/mol |
| Exact Mass | 106.09 |
| IUPAC Name | hydrazine;methylurea |
| SMILES | CNC(N)=O.NN |
| InChI | InChI=1S/C2H6N2O.H4N2/c1-4-2(3)5;1-2/h1H3,(H3,3,4,5);1-2H2 |
| InChIKey | HTIMTSMXHAWFCC-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.13 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;methylurea?
The IUPAC name of hydrazine;methylurea (CID 158581810) is hydrazine;methylurea.
What is the SMILES notation for hydrazine;methylurea?
The canonical SMILES for hydrazine;methylurea is CNC(N)=O.NN.
What is the InChIKey of hydrazine;methylurea?
The InChIKey is HTIMTSMXHAWFCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O.H4N2/c1-4-2(3)5;1-2/h1H3,(H3,3,4,5);1-2H2.
What are the key properties of hydrazine;methylurea?
hydrazine;methylurea has a molecular weight of 106.13 g/mol, XLogP of -1.90, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;methylurea is sourced from PubChem (CID 158581810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).