About 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane
1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane (PubChem CID 158582270) has the molecular formula C14H28O4
and a molecular weight of 260.37 g/mol. Its IUPAC name is 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane.
Molecular Properties
| Compound Name | 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane |
| PubChem CID | 158582270 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane |
| SMILES | C1COCCO1.CC(C)C1(C(C)C)COCCO1 |
| InChI | InChI=1S/C10H20O2.C4H8O2/c1-8(2)10(9(3)4)7-11-5-6-12-10;1-2-6-4-3-5-1/h8-9H,5-7H2,1-4H3;1-4H2 |
| InChIKey | HTJZGJKQFFYXIN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane?
The IUPAC name of 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane (CID 158582270) is 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane.
What is the SMILES notation for 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane?
The canonical SMILES for 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane is C1COCCO1.CC(C)C1(C(C)C)COCCO1.
What is the InChIKey of 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane?
The InChIKey is HTJZGJKQFFYXIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.C4H8O2/c1-8(2)10(9(3)4)7-11-5-6-12-10;1-2-6-4-3-5-1/h8-9H,5-7H2,1-4H3;1-4H2.
What are the key properties of 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane?
1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane has a molecular weight of 260.37 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane is sourced from PubChem (CID 158582270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).