C14H28O4 — CID 158582270
1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane (PubChem CID 158582270) has the molecular formula C14H28O4 and a molecular weight of 260.37 g/mol. Its IUPAC name is 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane.
| Compound Name | 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane |
|---|---|
| PubChem CID | 158582270 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 1,4-dioxane;2,2-di(propan-2-yl)-1,4-dioxane |
| SMILES | C1COCCO1.CC(C)C1(C(C)C)COCCO1 |
| InChI | InChI=1S/C10H20O2.C4H8O2/c1-8(2)10(9(3)4)7-11-5-6-12-10;1-2-6-4-3-5-1/h8-9H,5-7H2,1-4H3;1-4H2 |
| InChIKey | HTJZGJKQFFYXIN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |