C27H48O2Si — CID 158582771
(1S,6R,8R,9R,10S,11R,13R,15R)-9-[tert-butyl(dimethyl)silyl]oxy-1,4,8,12,12,15-hexamethyltetracyclo[8.5.0.02,6.011,13]pentadec-2-en-4-ol (PubChem CID 158582771) has the molecular formula C27H48O2Si and a molecular weight of 432.77 g/mol. Its IUPAC name is (1S,6R,8R,9R,10S,11R,13R,15R)-9-[tert-butyl(dimethyl)silyl]oxy-1,4,8,12,12,15-hexamethyltetracyclo[8.5.0.02,6.011,13]pentadec-2-en-4-ol.
| Compound Name | (1S,6R,8R,9R,10S,11R,13R,15R)-9-[tert-butyl(dimethyl)silyl]oxy-1,4,8,12,12,15-hexamethyltetracyclo[8.5.0.02,6.011,13]pentadec-2-en-4-ol |
|---|---|
| PubChem CID | 158582771 |
| Molecular Formula | C27H48O2Si |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | (1S,6R,8R,9R,10S,11R,13R,15R)-9-[tert-butyl(dimethyl)silyl]oxy-1,4,8,12,12,15-hexamethyltetracyclo[8.5.0.02,6.011,13]pentadec-2-en-4-ol |
| SMILES | C[C@@H]1C[C@@H]2CC(C)(O)C=C2[C@]2(C)[C@@H]([C@@H]1O[Si](C)(C)C(C)(C)C)[C@H]1[C@@H](C[C@H]2C)C1(C)C |
| InChI | InChI=1S/C27H48O2Si/c1-16-12-18-14-26(8,28)15-20(18)27(9)17(2)13-19-21(25(19,6)7)22(27)23(16)29-30(10,11)24(3,4)5/h15-19,21-23,28H,12-14H2,1-11H3/t16-,17-,18-,19-,21-,22-,23-,26?,27-/m1/s1 |
| InChIKey | RBECVGAPZHYHOA-UJAQXCAWSA-N |
| XLogP | 7.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|