C26H30N4O5S — CID 158583109
ethyl 2-[[4-imino-3-[4-(1H-indol-2-yl)-4-oxobutyl]-6,7-dimethoxy-1,2-dihydroquinazolin-2-yl]sulfanyl]acetate (PubChem CID 158583109) has the molecular formula C26H30N4O5S and a molecular weight of 510.62 g/mol. Its IUPAC name is ethyl 2-[[4-imino-3-[4-(1H-indol-2-yl)-4-oxobutyl]-6,7-dimethoxy-1,2-dihydroquinazolin-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[4-imino-3-[4-(1H-indol-2-yl)-4-oxobutyl]-6,7-dimethoxy-1,2-dihydroquinazolin-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 158583109 |
| Molecular Formula | C26H30N4O5S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | ethyl 2-[[4-imino-3-[4-(1H-indol-2-yl)-4-oxobutyl]-6,7-dimethoxy-1,2-dihydroquinazolin-2-yl]sulfanyl]acetate |
| SMILES | [H]/N=C1\c2cc(OC)c(OC)cc2NC(SCC(=O)OCC)N1CCCC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H30N4O5S/c1-4-35-24(32)15-36-26-29-19-14-23(34-3)22(33-2)13-17(19)25(27)30(26)11-7-10-21(31)20-12-16-8-5-6-9-18(16)28-20/h5-6,8-9,12-14,26-29H,4,7,10-11,15H2,1-3H3/b27-25+ |
| InChIKey | HTMLKAAELZPOGB-IMVLJIQESA-N |
| XLogP | 4.48 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|