C30H39BF5N5O4 — CID 158584060
(2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(2R)-4-(5,7-difluoro-1,3,3-trimethyl-2,1-benzoxaborol-6-yl)-3-oxo-1-[4-(trifluoromethyl)phenyl]butan-2-yl]pentanediamide (PubChem CID 158584060) has the molecular formula C30H39BF5N5O4 and a molecular weight of 639.48 g/mol. Its IUPAC name is (2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(2R)-4-(5,7-difluoro-1,3,3-trimethyl-2,1-benzoxaborol-6-yl)-3-oxo-1-[4-(trifluoromethyl)phenyl]butan-2-yl]pentanediamide.
| Compound Name | (2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(2R)-4-(5,7-difluoro-1,3,3-trimethyl-2,1-benzoxaborol-6-yl)-3-oxo-1-[4-(trifluoromethyl)phenyl]butan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 158584060 |
| Molecular Formula | C30H39BF5N5O4 |
| Molecular Weight | 639.48 g/mol |
| Exact Mass | 639.30 |
| IUPAC Name | (2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(2R)-4-(5,7-difluoro-1,3,3-trimethyl-2,1-benzoxaborol-6-yl)-3-oxo-1-[4-(trifluoromethyl)phenyl]butan-2-yl]pentanediamide |
| SMILES | CB1OC(C)(C)c2cc(F)c(CC(=O)[C@@H](Cc3ccc(C(F)(F)F)cc3)NC(=O)[C@@H](N)CCC(=O)N(CCN)CCN)c(F)c21 |
| InChI | InChI=1S/C30H39BF5N5O4/c1-29(2)20-16-21(32)19(27(33)26(20)31(3)45-29)15-24(42)23(14-17-4-6-18(7-5-17)30(34,35)36)40-28(44)22(39)8-9-25(43)41(12-10-37)13-11-38/h4-7,16,22-23H,8-15,37-39H2,1-3H3,(H,40,44)/t22-,23+/m0/s1 |
| InChIKey | KKDBSSOSSWMOMQ-XZOQPEGZSA-N |
| XLogP | 1.77 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|